C19H38INO5Si — CID 10951376
tert-butyl N-[(1S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-iodoethyl]carbamate (PubChem CID 10951376) has the molecular formula C19H38INO5Si and a molecular weight of 515.51 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-iodoethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-iodoethyl]carbamate |
|---|---|
| PubChem CID | 10951376 |
| Molecular Formula | C19H38INO5Si |
| Molecular Weight | 515.51 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | tert-butyl N-[(1S)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-iodoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CI)[C@@H]1OC(C)(C)O[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38INO5Si/c1-17(2,3)26-16(22)21-13(11-20)15-14(24-19(7,8)25-15)12-23-27(9,10)18(4,5)6/h13-15H,11-12H2,1-10H3,(H,21,22)/t13-,14+,15+/m1/s1 |
| InChIKey | HNHXMMUUHGFZBM-ILXRZTDVSA-N |
| XLogP | 4.86 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|