C28H32O4S2Si — CID 10951500
(1S,3R,4S,5S,7R,8S)-8-[tert-butyl(diphenyl)silyl]oxy-5-oxo-3-phenylsulfanyl-2-oxa-5λ4-thiabicyclo[2.2.2]octan-7-ol (PubChem CID 10951500) has the molecular formula C28H32O4S2Si and a molecular weight of 524.78 g/mol. Its IUPAC name is (1S,3R,4S,5S,7R,8S)-8-[tert-butyl(diphenyl)silyl]oxy-5-oxo-3-phenylsulfanyl-2-oxa-5λ4-thiabicyclo[2.2.2]octan-7-ol.
| Compound Name | (1S,3R,4S,5S,7R,8S)-8-[tert-butyl(diphenyl)silyl]oxy-5-oxo-3-phenylsulfanyl-2-oxa-5λ4-thiabicyclo[2.2.2]octan-7-ol |
|---|---|
| PubChem CID | 10951500 |
| Molecular Formula | C28H32O4S2Si |
| Molecular Weight | 524.78 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | (1S,3R,4S,5S,7R,8S)-8-[tert-butyl(diphenyl)silyl]oxy-5-oxo-3-phenylsulfanyl-2-oxa-5λ4-thiabicyclo[2.2.2]octan-7-ol |
| SMILES | CC(C)(C)[Si](O[C@H]1[C@H](O)[C@H]2C[S@@](=O)[C@@H]1[C@@H](Sc1ccccc1)O2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32O4S2Si/c1-28(2,3)35(21-15-9-5-10-16-21,22-17-11-6-12-18-22)32-25-24(29)23-19-34(30)26(25)27(31-23)33-20-13-7-4-8-14-20/h4-18,23-27,29H,19H2,1-3H3/t23-,24-,25+,26+,27-,34-/m1/s1 |
| InChIKey | VURLRGMPTOKMAV-SFWVDTQBSA-N |
| XLogP | 3.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.78 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|