C29H32ClNO6 — CID 10951511
[2-chloro-6-[(2E,6E)-7-[(2S)-5,5-dimethyl-4-oxooxolan-2-yl]-3-methylocta-2,6-dienyl]-4-formyl-5-hydroxy-3-methylphenyl] pyridine-4-carboxylate (PubChem CID 10951511) has the molecular formula C29H32ClNO6 and a molecular weight of 526.03 g/mol. Its IUPAC name is [2-chloro-6-[(2E,6E)-7-[(2S)-5,5-dimethyl-4-oxooxolan-2-yl]-3-methylocta-2,6-dienyl]-4-formyl-5-hydroxy-3-methylphenyl] pyridine-4-carboxylate.
| Compound Name | [2-chloro-6-[(2E,6E)-7-[(2S)-5,5-dimethyl-4-oxooxolan-2-yl]-3-methylocta-2,6-dienyl]-4-formyl-5-hydroxy-3-methylphenyl] pyridine-4-carboxylate |
|---|---|
| PubChem CID | 10951511 |
| Molecular Formula | C29H32ClNO6 |
| Molecular Weight | 526.03 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | [2-chloro-6-[(2E,6E)-7-[(2S)-5,5-dimethyl-4-oxooxolan-2-yl]-3-methylocta-2,6-dienyl]-4-formyl-5-hydroxy-3-methylphenyl] pyridine-4-carboxylate |
| SMILES | C/C(=C\Cc1c(O)c(C=O)c(C)c(Cl)c1OC(=O)c1ccncc1)CC/C=C(\C)[C@@H]1CC(=O)C(C)(C)O1 |
| InChI | InChI=1S/C29H32ClNO6/c1-17(7-6-8-18(2)23-15-24(33)29(4,5)37-23)9-10-21-26(34)22(16-32)19(3)25(30)27(21)36-28(35)20-11-13-31-14-12-20/h8-9,11-14,16,23,34H,6-7,10,15H2,1-5H3/b17-9+,18-8+/t23-/m0/s1 |
| InChIKey | FWOCATQHQHHUIS-PAQJXKOCSA-N |
| XLogP | 6.13 |
| TPSA | 102.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.03 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|