C27H50O6Si2 — CID 10951529
methyl (4'S,4'aR,5'R,8'aR)-4',5'-bis[[tert-butyl(dimethyl)silyl]oxy]-8'-methylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,8a-hexahydronaphthalene]-4'a-carboxylate (PubChem CID 10951529) has the molecular formula C27H50O6Si2 and a molecular weight of 526.86 g/mol. Its IUPAC name is methyl (4'S,4'aR,5'R,8'aR)-4',5'-bis[[tert-butyl(dimethyl)silyl]oxy]-8'-methylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,8a-hexahydronaphthalene]-4'a-carboxylate.
| Compound Name | methyl (4'S,4'aR,5'R,8'aR)-4',5'-bis[[tert-butyl(dimethyl)silyl]oxy]-8'-methylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,8a-hexahydronaphthalene]-4'a-carboxylate |
|---|---|
| PubChem CID | 10951529 |
| Molecular Formula | C27H50O6Si2 |
| Molecular Weight | 526.86 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | methyl (4'S,4'aR,5'R,8'aR)-4',5'-bis[[tert-butyl(dimethyl)silyl]oxy]-8'-methylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,8a-hexahydronaphthalene]-4'a-carboxylate |
| SMILES | COC(=O)[C@@]12[C@@H](O[Si](C)(C)C(C)(C)C)CCC3(OCCO3)[C@@H]1C(C)=CC[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H50O6Si2/c1-19-13-14-20(32-34(9,10)24(2,3)4)27(23(28)29-8)21(33-35(11,12)25(5,6)7)15-16-26(22(19)27)30-17-18-31-26/h13,20-22H,14-18H2,1-12H3/t20-,21+,22+,27+/m1/s1 |
| InChIKey | QJOFGYDHYXEKQD-HLIRBWCUSA-N |
| XLogP | 6.43 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.86 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|