C32H50O4S — CID 10951567
(3R,12R,14S)-12,14-dimethyl-3-[(4-methylphenyl)sulfonylmethyl]-15-phenylmethoxypentadecan-7-ol (PubChem CID 10951567) has the molecular formula C32H50O4S and a molecular weight of 530.82 g/mol. Its IUPAC name is (3R,12R,14S)-12,14-dimethyl-3-[(4-methylphenyl)sulfonylmethyl]-15-phenylmethoxypentadecan-7-ol.
| Compound Name | (3R,12R,14S)-12,14-dimethyl-3-[(4-methylphenyl)sulfonylmethyl]-15-phenylmethoxypentadecan-7-ol |
|---|---|
| PubChem CID | 10951567 |
| Molecular Formula | C32H50O4S |
| Molecular Weight | 530.82 g/mol |
| Exact Mass | 530.34 |
| IUPAC Name | (3R,12R,14S)-12,14-dimethyl-3-[(4-methylphenyl)sulfonylmethyl]-15-phenylmethoxypentadecan-7-ol |
| SMILES | CC[C@H](CCCC(O)CCCC[C@@H](C)C[C@H](C)COCc1ccccc1)CS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C32H50O4S/c1-5-29(25-37(34,35)32-20-18-26(2)19-21-32)15-11-17-31(33)16-10-9-12-27(3)22-28(4)23-36-24-30-13-7-6-8-14-30/h6-8,13-14,18-21,27-29,31,33H,5,9-12,15-17,22-25H2,1-4H3/t27-,28+,29-,31?/m1/s1 |
| InChIKey | VSVPICLZGMQWHB-ABFBDFFOSA-N |
| XLogP | 7.77 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.82 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|