C29H44O5SSi — CID 10951578
[(2R,3S,4S)-6-(benzenesulfonyl)-3-methyl-2-(4-phenylmethoxybutyl)oxan-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10951578) has the molecular formula C29H44O5SSi and a molecular weight of 532.82 g/mol. Its IUPAC name is [(2R,3S,4S)-6-(benzenesulfonyl)-3-methyl-2-(4-phenylmethoxybutyl)oxan-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3S,4S)-6-(benzenesulfonyl)-3-methyl-2-(4-phenylmethoxybutyl)oxan-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10951578 |
| Molecular Formula | C29H44O5SSi |
| Molecular Weight | 532.82 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | [(2R,3S,4S)-6-(benzenesulfonyl)-3-methyl-2-(4-phenylmethoxybutyl)oxan-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(S(=O)(=O)c2ccccc2)O[C@@H]1CCCCOCc1ccccc1 |
| InChI | InChI=1S/C29H44O5SSi/c1-23-26(19-13-14-20-32-22-24-15-9-7-10-16-24)33-28(35(30,31)25-17-11-8-12-18-25)21-27(23)34-36(5,6)29(2,3)4/h7-12,15-18,23,26-28H,13-14,19-22H2,1-6H3/t23-,26+,27-,28?/m0/s1 |
| InChIKey | ZWUXHNIRJNFOPE-YNFGBMAPSA-N |
| XLogP | 6.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.82 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|