C23H39IO4Si — CID 10951588
2-[(E,2R)-4-iodopent-3-en-2-yl]-3,5-dimethyl-6-[(2R,3S)-3-(2-trimethylsilylethoxymethoxy)pentan-2-yl]pyran-4-one (PubChem CID 10951588) has the molecular formula C23H39IO4Si and a molecular weight of 534.55 g/mol. Its IUPAC name is 2-[(E,2R)-4-iodopent-3-en-2-yl]-3,5-dimethyl-6-[(2R,3S)-3-(2-trimethylsilylethoxymethoxy)pentan-2-yl]pyran-4-one.
| Compound Name | 2-[(E,2R)-4-iodopent-3-en-2-yl]-3,5-dimethyl-6-[(2R,3S)-3-(2-trimethylsilylethoxymethoxy)pentan-2-yl]pyran-4-one |
|---|---|
| PubChem CID | 10951588 |
| Molecular Formula | C23H39IO4Si |
| Molecular Weight | 534.55 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | 2-[(E,2R)-4-iodopent-3-en-2-yl]-3,5-dimethyl-6-[(2R,3S)-3-(2-trimethylsilylethoxymethoxy)pentan-2-yl]pyran-4-one |
| SMILES | CC[C@H](OCOCC[Si](C)(C)C)[C@@H](C)c1oc([C@H](C)/C=C(\C)I)c(C)c(=O)c1C |
| InChI | InChI=1S/C23H39IO4Si/c1-10-20(27-14-26-11-12-29(7,8)9)17(4)23-19(6)21(25)18(5)22(28-23)15(2)13-16(3)24/h13,15,17,20H,10-12,14H2,1-9H3/b16-13+/t15-,17-,20+/m1/s1 |
| InChIKey | VNLABXJQPGOQFN-HMMNOTCSSA-N |
| XLogP | 6.91 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.55 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|