C23H31F3N2O7SSi — CID 10951895
methyl 3-[1-(benzenesulfonyl)-6-oxo-2,3-dihydropyridin-5-yl]-2-[(2,2,2-trifluoroacetyl)-(2-trimethylsilylethoxymethyl)amino]propanoate (PubChem CID 10951895) has the molecular formula C23H31F3N2O7SSi and a molecular weight of 564.66 g/mol. Its IUPAC name is methyl 3-[1-(benzenesulfonyl)-6-oxo-2,3-dihydropyridin-5-yl]-2-[(2,2,2-trifluoroacetyl)-(2-trimethylsilylethoxymethyl)amino]propanoate.
| Compound Name | methyl 3-[1-(benzenesulfonyl)-6-oxo-2,3-dihydropyridin-5-yl]-2-[(2,2,2-trifluoroacetyl)-(2-trimethylsilylethoxymethyl)amino]propanoate |
|---|---|
| PubChem CID | 10951895 |
| Molecular Formula | C23H31F3N2O7SSi |
| Molecular Weight | 564.66 g/mol |
| Exact Mass | 564.16 |
| IUPAC Name | methyl 3-[1-(benzenesulfonyl)-6-oxo-2,3-dihydropyridin-5-yl]-2-[(2,2,2-trifluoroacetyl)-(2-trimethylsilylethoxymethyl)amino]propanoate |
| SMILES | COC(=O)C(CC1=CCCN(S(=O)(=O)c2ccccc2)C1=O)N(COCC[Si](C)(C)C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C23H31F3N2O7SSi/c1-34-21(30)19(27(22(31)23(24,25)26)16-35-13-14-37(2,3)4)15-17-9-8-12-28(20(17)29)36(32,33)18-10-6-5-7-11-18/h5-7,9-11,19H,8,12-16H2,1-4H3 |
| InChIKey | ALOFIMKTIPVQNY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.66 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|