C33H60O6Si — CID 10952006
ethyl (2E,4R,5S,6S,8E,10E,12S)-5-[diethyl(propan-2-yl)silyl]oxy-12-methoxy-2,4,6,8-tetramethyl-12-[(4R,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]dodeca-2,8,10-trienoate (PubChem CID 10952006) has the molecular formula C33H60O6Si and a molecular weight of 580.92 g/mol. Its IUPAC name is ethyl (2E,4R,5S,6S,8E,10E,12S)-5-[diethyl(propan-2-yl)silyl]oxy-12-methoxy-2,4,6,8-tetramethyl-12-[(4R,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]dodeca-2,8,10-trienoate.
| Compound Name | ethyl (2E,4R,5S,6S,8E,10E,12S)-5-[diethyl(propan-2-yl)silyl]oxy-12-methoxy-2,4,6,8-tetramethyl-12-[(4R,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]dodeca-2,8,10-trienoate |
|---|---|
| PubChem CID | 10952006 |
| Molecular Formula | C33H60O6Si |
| Molecular Weight | 580.92 g/mol |
| Exact Mass | 580.42 |
| IUPAC Name | ethyl (2E,4R,5S,6S,8E,10E,12S)-5-[diethyl(propan-2-yl)silyl]oxy-12-methoxy-2,4,6,8-tetramethyl-12-[(4R,5S)-2,2,5-trimethyl-1,3-dioxan-4-yl]dodeca-2,8,10-trienoate |
| SMILES | CCOC(=O)/C(C)=C/[C@@H](C)[C@@H](O[Si](CC)(CC)C(C)C)[C@@H](C)C/C(C)=C/C=C/[C@H](OC)[C@@H]1OC(C)(C)OC[C@@H]1C |
| InChI | InChI=1S/C33H60O6Si/c1-14-36-32(34)27(9)21-26(8)30(39-40(15-2,16-3)23(4)5)25(7)20-24(6)18-17-19-29(35-13)31-28(10)22-37-33(11,12)38-31/h17-19,21,23,25-26,28-31H,14-16,20,22H2,1-13H3/b19-17+,24-18+,27-21+/t25-,26+,28-,29-,30-,31+/m0/s1 |
| InChIKey | UTBWODWZUPYBLV-LOUVKRMFSA-N |
| XLogP | 8.24 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.92 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|