About CID 10952040
CID 10952040 (PubChem CID 10952040) has the molecular formula C20H23O3Sn
and a molecular weight of 430.11 g/mol.
Molecular Properties
| Compound Name | CID 10952040 |
| PubChem CID | 10952040 |
| Molecular Formula | C20H23O3Sn |
| Molecular Weight | 430.11 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | — |
| SMILES | CC1(C)OC(=O)C(CCC[Sn](c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C8H13O3.2C6H5.Sn/c1-4-5-6-7(9)11-8(2,3)10-6;2*1-2-4-6-5-3-1;/h6H,1,4-5H2,2-3H3;2*1-5H; |
| InChIKey | CIROTGIMVUYTKR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.11 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 10952040 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10952040?
The IUPAC name of CID 10952040 (CID 10952040) is not available.
What is the SMILES notation for CID 10952040?
The canonical SMILES for CID 10952040 is CC1(C)OC(=O)C(CCC[Sn](c2ccccc2)c2ccccc2)O1.
What is the InChIKey of CID 10952040?
The InChIKey is CIROTGIMVUYTKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13O3.2C6H5.Sn/c1-4-5-6-7(9)11-8(2,3)10-6;2*1-2-4-6-5-3-1;/h6H,1,4-5H2,2-3H3;2*1-5H;.
What are the key properties of CID 10952040?
CID 10952040 has a molecular weight of 430.11 g/mol, XLogP of 2.75, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10952040 is sourced from PubChem (CID 10952040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).