C31H46O11 — CID 10952100
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2R)-1-phenylmethoxydecan-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 10952100) has the molecular formula C31H46O11 and a molecular weight of 594.70 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2R)-1-phenylmethoxydecan-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2R)-1-phenylmethoxydecan-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10952100 |
| Molecular Formula | C31H46O11 |
| Molecular Weight | 594.70 g/mol |
| Exact Mass | 594.30 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2R)-1-phenylmethoxydecan-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CCCCCCCC[C@H](COCc1ccccc1)O[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C31H46O11/c1-6-7-8-9-10-14-17-26(19-36-18-25-15-12-11-13-16-25)41-31-30(40-24(5)35)29(39-23(4)34)28(38-22(3)33)27(42-31)20-37-21(2)32/h11-13,15-16,26-31H,6-10,14,17-20H2,1-5H3/t26-,27-,28-,29+,30-,31-/m1/s1 |
| InChIKey | IHUFWOMIDYRSHQ-IOTQWNSASA-N |
| XLogP | 4.42 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.70 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|