C42H52O7SSi — CID 10952698
(1S,2R,6R,7S,12S)-12-[2-(benzenesulfonyl)ethyl]-7-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-11,11-dimethyl-2-propan-2-yl-3,5-dioxatricyclo[5.3.3.01,6]tridec-9-ene-4,8-dione (PubChem CID 10952698) has the molecular formula C42H52O7SSi and a molecular weight of 729.02 g/mol. Its IUPAC name is (1S,2R,6R,7S,12S)-12-[2-(benzenesulfonyl)ethyl]-7-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-11,11-dimethyl-2-propan-2-yl-3,5-dioxatricyclo[5.3.3.01,6]tridec-9-ene-4,8-dione.
| Compound Name | (1S,2R,6R,7S,12S)-12-[2-(benzenesulfonyl)ethyl]-7-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-11,11-dimethyl-2-propan-2-yl-3,5-dioxatricyclo[5.3.3.01,6]tridec-9-ene-4,8-dione |
|---|---|
| PubChem CID | 10952698 |
| Molecular Formula | C42H52O7SSi |
| Molecular Weight | 729.02 g/mol |
| Exact Mass | 728.32 |
| IUPAC Name | (1S,2R,6R,7S,12S)-12-[2-(benzenesulfonyl)ethyl]-7-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-11,11-dimethyl-2-propan-2-yl-3,5-dioxatricyclo[5.3.3.01,6]tridec-9-ene-4,8-dione |
| SMILES | CC(C)[C@H]1OC(=O)O[C@H]2[C@@]3(CCO[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)C[C@@H](CCS(=O)(=O)c4ccccc4)C(C)(C)[C@@]12C=CC3=O |
| InChI | InChI=1S/C42H52O7SSi/c1-30(2)36-42-25-23-35(43)41(37(42)49-38(44)48-36,29-31(40(42,6)7)24-28-50(45,46)32-17-11-8-12-18-32)26-27-47-51(39(3,4)5,33-19-13-9-14-20-33)34-21-15-10-16-22-34/h8-23,25,30-31,36-37H,24,26-29H2,1-7H3/t31-,36-,37+,41+,42+/m1/s1 |
| InChIKey | UDCGCSVTEKRTSB-GLULVPCVSA-N |
| XLogP | 7.53 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.02 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|