C47H36N4O — CID 10952700
24-(ethoxymethyl)-2,7,12,17-tetraphenyl-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11,13(22),14,16,18(21),19-undecaene (PubChem CID 10952700) has the molecular formula C47H36N4O and a molecular weight of 672.83 g/mol. Its IUPAC name is 24-(ethoxymethyl)-2,7,12,17-tetraphenyl-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11,13(22),14,16,18(21),19-undecaene.
| Compound Name | 24-(ethoxymethyl)-2,7,12,17-tetraphenyl-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11,13(22),14,16,18(21),19-undecaene |
|---|---|
| PubChem CID | 10952700 |
| Molecular Formula | C47H36N4O |
| Molecular Weight | 672.83 g/mol |
| Exact Mass | 672.29 |
| IUPAC Name | 24-(ethoxymethyl)-2,7,12,17-tetraphenyl-4,21,22,23-tetrazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3,5,7,9,11,13(22),14,16,18(21),19-undecaene |
| SMILES | CCOCC1C2=CN=C1/C(c1ccccc1)=C1/C=CC(=N1)/C(c1ccccc1)=C1/C=CC(=N1)/C(c1ccccc1)=c1/cc/c([nH]1)=C/2c1ccccc1 |
| InChI | InChI=1S/C47H36N4O/c1-2-52-30-36-35-29-48-47(36)46(34-21-13-6-14-22-34)42-28-27-41(51-42)45(33-19-11-5-12-20-33)40-26-25-39(50-40)44(32-17-9-4-10-18-32)38-24-23-37(49-38)43(35)31-15-7-3-8-16-31/h3-29,36,49H,2,30H2,1H3/b43-35-,43-37-,44-38-,44-39-,45-40-,45-41-,46-42-,47-46+ |
| InChIKey | UUYNKECQXPBYBL-JYLUFDQCSA-N |
| XLogP | 8.26 |
| TPSA | 62.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.83 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |