C24H22N4O2 — CID 1095338
4,6-diphenoxy-N-(4-propan-2-ylphenyl)-1,3,5-triazin-2-amine (PubChem CID 1095338) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 4,6-diphenoxy-N-(4-propan-2-ylphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-diphenoxy-N-(4-propan-2-ylphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 1095338 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 4,6-diphenoxy-N-(4-propan-2-ylphenyl)-1,3,5-triazin-2-amine |
| SMILES | CC(C)c1ccc(Nc2nc(Oc3ccccc3)nc(Oc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H22N4O2/c1-17(2)18-13-15-19(16-14-18)25-22-26-23(29-20-9-5-3-6-10-20)28-24(27-22)30-21-11-7-4-8-12-21/h3-17H,1-2H3,(H,25,26,27,28) |
| InChIKey | OZGOUMLMKJLJSH-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |