prop-2-enyl hydrogen carbonate

C4H6O3 — CID 10953437

IUPACprop-2-enyl hydrogen carbonate
SMILESC=CCOC(=O)O
InChIInChI=1S/C4H6O3/c1-2-3-7-4(5)6/h2H,1,3H2,(H,5,6)
InChIKeyDQRVWGKCDJKPAQ-UHFFFAOYSA-N
MW102.09 g/mol
LogP0.87
Rot. Bonds2

About prop-2-enyl hydrogen carbonate

prop-2-enyl hydrogen carbonate (PubChem CID 10953437) has the molecular formula C4H6O3 and a molecular weight of 102.09 g/mol. Its IUPAC name is prop-2-enyl hydrogen carbonate.

Molecular Properties

Compound Nameprop-2-enyl hydrogen carbonate
PubChem CID10953437
Molecular FormulaC4H6O3
Molecular Weight102.09 g/mol
Exact Mass102.03
IUPAC Nameprop-2-enyl hydrogen carbonate
SMILESC=CCOC(=O)O
InChIInChI=1S/C4H6O3/c1-2-3-7-4(5)6/h2H,1,3H2,(H,5,6)
InChIKeyDQRVWGKCDJKPAQ-UHFFFAOYSA-N
XLogP0.87
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500102.09
LogP ≤ 50.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze prop-2-enyl hydrogen carbonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of prop-2-enyl hydrogen carbonate?
The IUPAC name of prop-2-enyl hydrogen carbonate (CID 10953437) is prop-2-enyl hydrogen carbonate.
What is the SMILES notation for prop-2-enyl hydrogen carbonate?
The canonical SMILES for prop-2-enyl hydrogen carbonate is C=CCOC(=O)O.
What is the InChIKey of prop-2-enyl hydrogen carbonate?
The InChIKey is DQRVWGKCDJKPAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O3/c1-2-3-7-4(5)6/h2H,1,3H2,(H,5,6).
What are the key properties of prop-2-enyl hydrogen carbonate?
prop-2-enyl hydrogen carbonate has a molecular weight of 102.09 g/mol, XLogP of 0.87, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl hydrogen carbonate is sourced from PubChem (CID 10953437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).