About 2-ethyl-3-methylbutanoic acid
2-ethyl-3-methylbutanoic acid (PubChem CID 10953545) has the molecular formula C7H14O2
and a molecular weight of 130.19 g/mol. Its IUPAC name is 2-ethyl-3-methylbutanoic acid.
Molecular Properties
| Compound Name | 2-ethyl-3-methylbutanoic acid |
| PubChem CID | 10953545 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | 2-ethyl-3-methylbutanoic acid |
| SMILES | CCC(C(=O)O)C(C)C |
| InChI | InChI=1S/C7H14O2/c1-4-6(5(2)3)7(8)9/h5-6H,4H2,1-3H3,(H,8,9) |
| InChIKey | XJCPTWKSNPIJRN-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-3-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-methylbutanoic acid?
The IUPAC name of 2-ethyl-3-methylbutanoic acid (CID 10953545) is 2-ethyl-3-methylbutanoic acid.
What is the SMILES notation for 2-ethyl-3-methylbutanoic acid?
The canonical SMILES for 2-ethyl-3-methylbutanoic acid is CCC(C(=O)O)C(C)C.
What is the InChIKey of 2-ethyl-3-methylbutanoic acid?
The InChIKey is XJCPTWKSNPIJRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2/c1-4-6(5(2)3)7(8)9/h5-6H,4H2,1-3H3,(H,8,9).
What are the key properties of 2-ethyl-3-methylbutanoic acid?
2-ethyl-3-methylbutanoic acid has a molecular weight of 130.19 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-methylbutanoic acid is sourced from PubChem (CID 10953545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).