About spiro[1,3-dioxolane-2,2'-7-oxabicyclo[4.1.0]heptane]
spiro[1,3-dioxolane-2,2'-7-oxabicyclo[4.1.0]heptane] (PubChem CID 10953761) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,2'-7-oxabicyclo[4.1.0]heptane].
Molecular Properties
| Compound Name | spiro[1,3-dioxolane-2,2'-7-oxabicyclo[4.1.0]heptane] |
| PubChem CID | 10953761 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | spiro[1,3-dioxolane-2,2'-7-oxabicyclo[4.1.0]heptane] |
| SMILES | C1CC2OC2C2(C1)OCCO2 |
| InChI | InChI=1S/C8H12O3/c1-2-6-7(11-6)8(3-1)9-4-5-10-8/h6-7H,1-5H2 |
| InChIKey | SMTPTMRVCZTPTI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze spiro[1,3-dioxolane-2,2'-7-oxabicyclo[4.1.0]heptane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-dioxolane-2,2'-7-oxabicyclo[4.1.0]heptane]?
The IUPAC name of spiro[1,3-dioxolane-2,2'-7-oxabicyclo[4.1.0]heptane] (CID 10953761) is spiro[1,3-dioxolane-2,2'-7-oxabicyclo[4.1.0]heptane].
What is the SMILES notation for spiro[1,3-dioxolane-2,2'-7-oxabicyclo[4.1.0]heptane]?
The canonical SMILES for spiro[1,3-dioxolane-2,2'-7-oxabicyclo[4.1.0]heptane] is C1CC2OC2C2(C1)OCCO2.
What is the InChIKey of spiro[1,3-dioxolane-2,2'-7-oxabicyclo[4.1.0]heptane]?
The InChIKey is SMTPTMRVCZTPTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3/c1-2-6-7(11-6)8(3-1)9-4-5-10-8/h6-7H,1-5H2.
What are the key properties of spiro[1,3-dioxolane-2,2'-7-oxabicyclo[4.1.0]heptane]?
spiro[1,3-dioxolane-2,2'-7-oxabicyclo[4.1.0]heptane] has a molecular weight of 156.18 g/mol, XLogP of 0.68, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-dioxolane-2,2'-7-oxabicyclo[4.1.0]heptane] is sourced from PubChem (CID 10953761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).