About 8-methyl-1,4-dioxaspiro[4.5]decane
8-methyl-1,4-dioxaspiro[4.5]decane (PubChem CID 10953772) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is 8-methyl-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8-methyl-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 10953772 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 8-methyl-1,4-dioxaspiro[4.5]decane |
| SMILES | CC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C9H16O2/c1-8-2-4-9(5-3-8)10-6-7-11-9/h8H,2-7H2,1H3 |
| InChIKey | VBUPAIUJQXLIBZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-methyl-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-1,4-dioxaspiro[4.5]decane?
The IUPAC name of 8-methyl-1,4-dioxaspiro[4.5]decane (CID 10953772) is 8-methyl-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for 8-methyl-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for 8-methyl-1,4-dioxaspiro[4.5]decane is CC1CCC2(CC1)OCCO2.
What is the InChIKey of 8-methyl-1,4-dioxaspiro[4.5]decane?
The InChIKey is VBUPAIUJQXLIBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-8-2-4-9(5-3-8)10-6-7-11-9/h8H,2-7H2,1H3.
What are the key properties of 8-methyl-1,4-dioxaspiro[4.5]decane?
8-methyl-1,4-dioxaspiro[4.5]decane has a molecular weight of 156.22 g/mol, XLogP of 1.94, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 10953772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).