C11H11N — CID 10953780
1,2,3,4-tetrahydronaphthalene-1-carbonitrile (PubChem CID 10953780) has the molecular formula C11H11N and a molecular weight of 157.22 g/mol. Its IUPAC name is 1,2,3,4-tetrahydronaphthalene-1-carbonitrile.
| Compound Name | 1,2,3,4-tetrahydronaphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 10953780 |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 1,2,3,4-tetrahydronaphthalene-1-carbonitrile |
| SMILES | N#CC1CCCc2ccccc21 |
| InChI | InChI=1S/C11H11N/c12-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-2,4,7,10H,3,5-6H2 |
| InChIKey | HMRIXHRQNXHLSL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |