About 3-methylquinolin-2-amine
3-methylquinolin-2-amine (PubChem CID 10953794) has the molecular formula C10H10N2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 3-methylquinolin-2-amine.
Molecular Properties
| Compound Name | 3-methylquinolin-2-amine |
| PubChem CID | 10953794 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 3-methylquinolin-2-amine |
| SMILES | Cc1cc2ccccc2nc1N |
| InChI | InChI=1S/C10H10N2/c1-7-6-8-4-2-3-5-9(8)12-10(7)11/h2-6H,1H3,(H2,11,12) |
| InChIKey | NCZOVCDTUUZEEA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylquinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylquinolin-2-amine?
The IUPAC name of 3-methylquinolin-2-amine (CID 10953794) is 3-methylquinolin-2-amine.
What is the SMILES notation for 3-methylquinolin-2-amine?
The canonical SMILES for 3-methylquinolin-2-amine is Cc1cc2ccccc2nc1N.
What is the InChIKey of 3-methylquinolin-2-amine?
The InChIKey is NCZOVCDTUUZEEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2/c1-7-6-8-4-2-3-5-9(8)12-10(7)11/h2-6H,1H3,(H2,11,12).
What are the key properties of 3-methylquinolin-2-amine?
3-methylquinolin-2-amine has a molecular weight of 158.20 g/mol, XLogP of 2.13, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylquinolin-2-amine is sourced from PubChem (CID 10953794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).