About 3-[(1Z)-4-methylpenta-1,3-dienyl]-2H-furan-5-one
3-[(1Z)-4-methylpenta-1,3-dienyl]-2H-furan-5-one (PubChem CID 10953862) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is 3-[(1Z)-4-methylpenta-1,3-dienyl]-2H-furan-5-one.
Molecular Properties
| Compound Name | 3-[(1Z)-4-methylpenta-1,3-dienyl]-2H-furan-5-one |
| PubChem CID | 10953862 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 3-[(1Z)-4-methylpenta-1,3-dienyl]-2H-furan-5-one |
| SMILES | CC(C)=C/C=C\C1=CC(=O)OC1 |
| InChI | InChI=1S/C10H12O2/c1-8(2)4-3-5-9-6-10(11)12-7-9/h3-6H,7H2,1-2H3/b5-3- |
| InChIKey | WTMZLLJMAPNMPS-HYXAFXHYSA-N |
| XLogP | 1.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1Z)-4-methylpenta-1,3-dienyl]-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1Z)-4-methylpenta-1,3-dienyl]-2H-furan-5-one?
The IUPAC name of 3-[(1Z)-4-methylpenta-1,3-dienyl]-2H-furan-5-one (CID 10953862) is 3-[(1Z)-4-methylpenta-1,3-dienyl]-2H-furan-5-one.
What is the SMILES notation for 3-[(1Z)-4-methylpenta-1,3-dienyl]-2H-furan-5-one?
The canonical SMILES for 3-[(1Z)-4-methylpenta-1,3-dienyl]-2H-furan-5-one is CC(C)=C/C=C\C1=CC(=O)OC1.
What is the InChIKey of 3-[(1Z)-4-methylpenta-1,3-dienyl]-2H-furan-5-one?
The InChIKey is WTMZLLJMAPNMPS-HYXAFXHYSA-N. The full InChI is InChI=1S/C10H12O2/c1-8(2)4-3-5-9-6-10(11)12-7-9/h3-6H,7H2,1-2H3/b5-3-.
What are the key properties of 3-[(1Z)-4-methylpenta-1,3-dienyl]-2H-furan-5-one?
3-[(1Z)-4-methylpenta-1,3-dienyl]-2H-furan-5-one has a molecular weight of 164.20 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1Z)-4-methylpenta-1,3-dienyl]-2H-furan-5-one is sourced from PubChem (CID 10953862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).