About dimethyl (Z)-2,3-dimethylbut-2-enedioate
dimethyl (Z)-2,3-dimethylbut-2-enedioate (PubChem CID 10953983) has the molecular formula C8H12O4
and a molecular weight of 172.18 g/mol. Its IUPAC name is dimethyl (Z)-2,3-dimethylbut-2-enedioate.
Molecular Properties
| Compound Name | dimethyl (Z)-2,3-dimethylbut-2-enedioate |
| PubChem CID | 10953983 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | dimethyl (Z)-2,3-dimethylbut-2-enedioate |
| SMILES | COC(=O)/C(C)=C(/C)C(=O)OC |
| InChI | InChI=1S/C8H12O4/c1-5(7(9)11-3)6(2)8(10)12-4/h1-4H3/b6-5- |
| InChIKey | OYJAKTNXALPBMX-WAYWQWQTSA-N |
| XLogP | 0.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (Z)-2,3-dimethylbut-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (Z)-2,3-dimethylbut-2-enedioate?
The IUPAC name of dimethyl (Z)-2,3-dimethylbut-2-enedioate (CID 10953983) is dimethyl (Z)-2,3-dimethylbut-2-enedioate.
What is the SMILES notation for dimethyl (Z)-2,3-dimethylbut-2-enedioate?
The canonical SMILES for dimethyl (Z)-2,3-dimethylbut-2-enedioate is COC(=O)/C(C)=C(/C)C(=O)OC.
What is the InChIKey of dimethyl (Z)-2,3-dimethylbut-2-enedioate?
The InChIKey is OYJAKTNXALPBMX-WAYWQWQTSA-N. The full InChI is InChI=1S/C8H12O4/c1-5(7(9)11-3)6(2)8(10)12-4/h1-4H3/b6-5-.
What are the key properties of dimethyl (Z)-2,3-dimethylbut-2-enedioate?
dimethyl (Z)-2,3-dimethylbut-2-enedioate has a molecular weight of 172.18 g/mol, XLogP of 0.67, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (Z)-2,3-dimethylbut-2-enedioate is sourced from PubChem (CID 10953983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).