C10H14N2O — CID 10954089
(3aS,7aS)-1-methyl-2-oxo-3,3a,4,5,6,7-hexahydroindole-7a-carbonitrile (PubChem CID 10954089) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is (3aS,7aS)-1-methyl-2-oxo-3,3a,4,5,6,7-hexahydroindole-7a-carbonitrile.
| Compound Name | (3aS,7aS)-1-methyl-2-oxo-3,3a,4,5,6,7-hexahydroindole-7a-carbonitrile |
|---|---|
| PubChem CID | 10954089 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | (3aS,7aS)-1-methyl-2-oxo-3,3a,4,5,6,7-hexahydroindole-7a-carbonitrile |
| SMILES | CN1C(=O)C[C@@H]2CCCC[C@@]21C#N |
| InChI | InChI=1S/C10H14N2O/c1-12-9(13)6-8-4-2-3-5-10(8,12)7-11/h8H,2-6H2,1H3/t8-,10+/m0/s1 |
| InChIKey | OISQBUVQEDMVRT-WCBMZHEXSA-N |
| XLogP | 1.30 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |