About (E)-1,1-difluoro-4-phenylbut-3-en-2-ol
(E)-1,1-difluoro-4-phenylbut-3-en-2-ol (PubChem CID 10954195) has the molecular formula C10H10F2O
and a molecular weight of 184.19 g/mol. Its IUPAC name is (E)-1,1-difluoro-4-phenylbut-3-en-2-ol.
Molecular Properties
| Compound Name | (E)-1,1-difluoro-4-phenylbut-3-en-2-ol |
| PubChem CID | 10954195 |
| Molecular Formula | C10H10F2O |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (E)-1,1-difluoro-4-phenylbut-3-en-2-ol |
| SMILES | OC(/C=C/c1ccccc1)C(F)F |
| InChI | InChI=1S/C10H10F2O/c11-10(12)9(13)7-6-8-4-2-1-3-5-8/h1-7,9-10,13H/b7-6+ |
| InChIKey | YUIGXLJYDWNLKI-VOTSOKGWSA-N |
| XLogP | 2.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E)-1,1-difluoro-4-phenylbut-3-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,1-difluoro-4-phenylbut-3-en-2-ol?
The IUPAC name of (E)-1,1-difluoro-4-phenylbut-3-en-2-ol (CID 10954195) is (E)-1,1-difluoro-4-phenylbut-3-en-2-ol.
What is the SMILES notation for (E)-1,1-difluoro-4-phenylbut-3-en-2-ol?
The canonical SMILES for (E)-1,1-difluoro-4-phenylbut-3-en-2-ol is OC(/C=C/c1ccccc1)C(F)F.
What is the InChIKey of (E)-1,1-difluoro-4-phenylbut-3-en-2-ol?
The InChIKey is YUIGXLJYDWNLKI-VOTSOKGWSA-N. The full InChI is InChI=1S/C10H10F2O/c11-10(12)9(13)7-6-8-4-2-1-3-5-8/h1-7,9-10,13H/b7-6+.
What are the key properties of (E)-1,1-difluoro-4-phenylbut-3-en-2-ol?
(E)-1,1-difluoro-4-phenylbut-3-en-2-ol has a molecular weight of 184.19 g/mol, XLogP of 2.33, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,1-difluoro-4-phenylbut-3-en-2-ol is sourced from PubChem (CID 10954195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).