C11H22O2 — CID 10954262
(E,3S)-5-ethyl-4,4-dimethylhept-5-ene-1,3-diol (PubChem CID 10954262) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is (E,3S)-5-ethyl-4,4-dimethylhept-5-ene-1,3-diol.
| Compound Name | (E,3S)-5-ethyl-4,4-dimethylhept-5-ene-1,3-diol |
|---|---|
| PubChem CID | 10954262 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | (E,3S)-5-ethyl-4,4-dimethylhept-5-ene-1,3-diol |
| SMILES | C/C=C(\CC)C(C)(C)[C@@H](O)CCO |
| InChI | InChI=1S/C11H22O2/c1-5-9(6-2)11(3,4)10(13)7-8-12/h5,10,12-13H,6-8H2,1-4H3/b9-5+/t10-/m0/s1 |
| InChIKey | WXAXJRWQUHMDQM-CYNRKNSPSA-N |
| XLogP | 2.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|