About (1S,7R)-4-bromotricyclo[4.1.0.02,7]hept-4-en-3-ol
(1S,7R)-4-bromotricyclo[4.1.0.02,7]hept-4-en-3-ol (PubChem CID 10954270) has the molecular formula C7H7BrO
and a molecular weight of 187.04 g/mol. Its IUPAC name is (1S,7R)-4-bromotricyclo[4.1.0.02,7]hept-4-en-3-ol.
Molecular Properties
| Compound Name | (1S,7R)-4-bromotricyclo[4.1.0.02,7]hept-4-en-3-ol |
| PubChem CID | 10954270 |
| Molecular Formula | C7H7BrO |
| Molecular Weight | 187.04 g/mol |
| Exact Mass | 185.97 |
| IUPAC Name | (1S,7R)-4-bromotricyclo[4.1.0.02,7]hept-4-en-3-ol |
| SMILES | OC1C(Br)=CC2[C@@H]3C1[C@H]23 |
| InChI | InChI=1S/C7H7BrO/c8-3-1-2-4-5(2)6(4)7(3)9/h1-2,4-7,9H/t2?,4-,5+,6?,7? |
| InChIKey | MAZKAXGQCKMJHW-SLMQOUOUSA-N |
| XLogP | 1.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.04 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S,7R)-4-bromotricyclo[4.1.0.02,7]hept-4-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,7R)-4-bromotricyclo[4.1.0.02,7]hept-4-en-3-ol?
The IUPAC name of (1S,7R)-4-bromotricyclo[4.1.0.02,7]hept-4-en-3-ol (CID 10954270) is (1S,7R)-4-bromotricyclo[4.1.0.02,7]hept-4-en-3-ol.
What is the SMILES notation for (1S,7R)-4-bromotricyclo[4.1.0.02,7]hept-4-en-3-ol?
The canonical SMILES for (1S,7R)-4-bromotricyclo[4.1.0.02,7]hept-4-en-3-ol is OC1C(Br)=CC2[C@@H]3C1[C@H]23.
What is the InChIKey of (1S,7R)-4-bromotricyclo[4.1.0.02,7]hept-4-en-3-ol?
The InChIKey is MAZKAXGQCKMJHW-SLMQOUOUSA-N. The full InChI is InChI=1S/C7H7BrO/c8-3-1-2-4-5(2)6(4)7(3)9/h1-2,4-7,9H/t2?,4-,5+,6?,7?.
What are the key properties of (1S,7R)-4-bromotricyclo[4.1.0.02,7]hept-4-en-3-ol?
(1S,7R)-4-bromotricyclo[4.1.0.02,7]hept-4-en-3-ol has a molecular weight of 187.04 g/mol, XLogP of 1.13, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,7R)-4-bromotricyclo[4.1.0.02,7]hept-4-en-3-ol is sourced from PubChem (CID 10954270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).