About 1-cyclohepta-1,3,5-trien-1-yl-3-(dimethylamino)propan-1-one
1-cyclohepta-1,3,5-trien-1-yl-3-(dimethylamino)propan-1-one (PubChem CID 10954373) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 1-cyclohepta-1,3,5-trien-1-yl-3-(dimethylamino)propan-1-one.
Molecular Properties
| Compound Name | 1-cyclohepta-1,3,5-trien-1-yl-3-(dimethylamino)propan-1-one |
| PubChem CID | 10954373 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 1-cyclohepta-1,3,5-trien-1-yl-3-(dimethylamino)propan-1-one |
| SMILES | CN(C)CCC(=O)C1=CC=CC=CC1 |
| InChI | InChI=1S/C12H17NO/c1-13(2)10-9-12(14)11-7-5-3-4-6-8-11/h3-7H,8-10H2,1-2H3 |
| InChIKey | MMDKYKRQLRLGQO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclohepta-1,3,5-trien-1-yl-3-(dimethylamino)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohepta-1,3,5-trien-1-yl-3-(dimethylamino)propan-1-one?
The IUPAC name of 1-cyclohepta-1,3,5-trien-1-yl-3-(dimethylamino)propan-1-one (CID 10954373) is 1-cyclohepta-1,3,5-trien-1-yl-3-(dimethylamino)propan-1-one.
What is the SMILES notation for 1-cyclohepta-1,3,5-trien-1-yl-3-(dimethylamino)propan-1-one?
The canonical SMILES for 1-cyclohepta-1,3,5-trien-1-yl-3-(dimethylamino)propan-1-one is CN(C)CCC(=O)C1=CC=CC=CC1.
What is the InChIKey of 1-cyclohepta-1,3,5-trien-1-yl-3-(dimethylamino)propan-1-one?
The InChIKey is MMDKYKRQLRLGQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-13(2)10-9-12(14)11-7-5-3-4-6-8-11/h3-7H,8-10H2,1-2H3.
What are the key properties of 1-cyclohepta-1,3,5-trien-1-yl-3-(dimethylamino)propan-1-one?
1-cyclohepta-1,3,5-trien-1-yl-3-(dimethylamino)propan-1-one has a molecular weight of 191.27 g/mol, XLogP of 1.95, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohepta-1,3,5-trien-1-yl-3-(dimethylamino)propan-1-one is sourced from PubChem (CID 10954373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).