C11H14O3 — CID 10954433
2-butyl-5-methoxycyclohexa-2,5-diene-1,4-dione (PubChem CID 10954433) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-butyl-5-methoxycyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-butyl-5-methoxycyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 10954433 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2-butyl-5-methoxycyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCCC1=CC(=O)C(OC)=CC1=O |
| InChI | InChI=1S/C11H14O3/c1-3-4-5-8-6-10(13)11(14-2)7-9(8)12/h6-7H,3-5H2,1-2H3 |
| InChIKey | QZGLDYQZORRYNH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|