About N,N-diethylethanamine;pentahydrofluoride
N,N-diethylethanamine;pentahydrofluoride (PubChem CID 10954597) has the molecular formula C6H20F5N
and a molecular weight of 201.22 g/mol. Its IUPAC name is N,N-diethylethanamine;pentahydrofluoride.
Molecular Properties
| Compound Name | N,N-diethylethanamine;pentahydrofluoride |
| PubChem CID | 10954597 |
| Molecular Formula | C6H20F5N |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | N,N-diethylethanamine;pentahydrofluoride |
| SMILES | CCN(CC)CC.F.F.F.F.F |
| InChI | InChI=1S/C6H15N.5FH/c1-4-7(5-2)6-3;;;;;/h4-6H2,1-3H3;5*1H |
| InChIKey | UQIRAGRGIYWEDH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-diethylethanamine;pentahydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;pentahydrofluoride?
The IUPAC name of N,N-diethylethanamine;pentahydrofluoride (CID 10954597) is N,N-diethylethanamine;pentahydrofluoride.
What is the SMILES notation for N,N-diethylethanamine;pentahydrofluoride?
The canonical SMILES for N,N-diethylethanamine;pentahydrofluoride is CCN(CC)CC.F.F.F.F.F.
What is the InChIKey of N,N-diethylethanamine;pentahydrofluoride?
The InChIKey is UQIRAGRGIYWEDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.5FH/c1-4-7(5-2)6-3;;;;;/h4-6H2,1-3H3;5*1H.
What are the key properties of N,N-diethylethanamine;pentahydrofluoride?
N,N-diethylethanamine;pentahydrofluoride has a molecular weight of 201.22 g/mol, XLogP of 2.11, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;pentahydrofluoride is sourced from PubChem (CID 10954597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).