About 1-tert-butyl-3,3-dinitroazetidine
1-tert-butyl-3,3-dinitroazetidine (PubChem CID 10954639) has the molecular formula C7H13N3O4
and a molecular weight of 203.20 g/mol. Its IUPAC name is 1-tert-butyl-3,3-dinitroazetidine.
Molecular Properties
| Compound Name | 1-tert-butyl-3,3-dinitroazetidine |
| PubChem CID | 10954639 |
| Molecular Formula | C7H13N3O4 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 1-tert-butyl-3,3-dinitroazetidine |
| SMILES | CC(C)(C)N1CC([N+](=O)[O-])([N+](=O)[O-])C1 |
| InChI | InChI=1S/C7H13N3O4/c1-6(2,3)8-4-7(5-8,9(11)12)10(13)14/h4-5H2,1-3H3 |
| InChIKey | YNVDAIOEJHCEQA-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-3,3-dinitroazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3,3-dinitroazetidine?
The IUPAC name of 1-tert-butyl-3,3-dinitroazetidine (CID 10954639) is 1-tert-butyl-3,3-dinitroazetidine.
What is the SMILES notation for 1-tert-butyl-3,3-dinitroazetidine?
The canonical SMILES for 1-tert-butyl-3,3-dinitroazetidine is CC(C)(C)N1CC([N+](=O)[O-])([N+](=O)[O-])C1.
What is the InChIKey of 1-tert-butyl-3,3-dinitroazetidine?
The InChIKey is YNVDAIOEJHCEQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O4/c1-6(2,3)8-4-7(5-8,9(11)12)10(13)14/h4-5H2,1-3H3.
What are the key properties of 1-tert-butyl-3,3-dinitroazetidine?
1-tert-butyl-3,3-dinitroazetidine has a molecular weight of 203.20 g/mol, XLogP of 0.35, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3,3-dinitroazetidine is sourced from PubChem (CID 10954639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).