C9H16ClNO2 — CID 10954707
(3R,3aR,6aS)-3-propyl-3,3a,4,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-ium-2-one chloride (PubChem CID 10954707) has the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. Its IUPAC name is (3R,3aR,6aS)-3-propyl-3,3a,4,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-ium-2-one chloride.
| Compound Name | (3R,3aR,6aS)-3-propyl-3,3a,4,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-ium-2-one chloride |
|---|---|
| PubChem CID | 10954707 |
| Molecular Formula | C9H16ClNO2 |
| Molecular Weight | 205.68 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | (3R,3aR,6aS)-3-propyl-3,3a,4,5,6,6a-hexahydrofuro[3,2-b]pyrrol-4-ium-2-one chloride |
| SMILES | CCC[C@H]1C(=O)O[C@H]2CC[NH2+][C@@H]21.[Cl-] |
| InChI | InChI=1S/C9H15NO2.ClH/c1-2-3-6-8-7(4-5-10-8)12-9(6)11;/h6-8,10H,2-5H2,1H3;1H/t6-,7+,8-;/m1./s1 |
| InChIKey | IVCFKNYHFGNJOI-ARIDFIBWSA-N |
| XLogP | -3.33 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.68 |
| LogP ≤ 5 | -3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |