About [(E,3S)-3-methoxy-2-methyl-4-[(2R)-oxiran-2-yl]but-1-enyl]-trimethylsilane
[(E,3S)-3-methoxy-2-methyl-4-[(2R)-oxiran-2-yl]but-1-enyl]-trimethylsilane (PubChem CID 10954921) has the molecular formula C11H22O2Si
and a molecular weight of 214.38 g/mol. Its IUPAC name is [(E,3S)-3-methoxy-2-methyl-4-[(2R)-oxiran-2-yl]but-1-enyl]-trimethylsilane.
Molecular Properties
| Compound Name | [(E,3S)-3-methoxy-2-methyl-4-[(2R)-oxiran-2-yl]but-1-enyl]-trimethylsilane |
| PubChem CID | 10954921 |
| Molecular Formula | C11H22O2Si |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | [(E,3S)-3-methoxy-2-methyl-4-[(2R)-oxiran-2-yl]but-1-enyl]-trimethylsilane |
| SMILES | CO[C@@H](C[C@@H]1CO1)/C(C)=C/[Si](C)(C)C |
| InChI | InChI=1S/C11H22O2Si/c1-9(8-14(3,4)5)11(12-2)6-10-7-13-10/h8,10-11H,6-7H2,1-5H3/b9-8+/t10-,11+/m1/s1 |
| InChIKey | VJTBWJHVIYXCBL-OJLMFNQTSA-N |
| XLogP | 2.61 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(E,3S)-3-methoxy-2-methyl-4-[(2R)-oxiran-2-yl]but-1-enyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,3S)-3-methoxy-2-methyl-4-[(2R)-oxiran-2-yl]but-1-enyl]-trimethylsilane?
The IUPAC name of [(E,3S)-3-methoxy-2-methyl-4-[(2R)-oxiran-2-yl]but-1-enyl]-trimethylsilane (CID 10954921) is [(E,3S)-3-methoxy-2-methyl-4-[(2R)-oxiran-2-yl]but-1-enyl]-trimethylsilane.
What is the SMILES notation for [(E,3S)-3-methoxy-2-methyl-4-[(2R)-oxiran-2-yl]but-1-enyl]-trimethylsilane?
The canonical SMILES for [(E,3S)-3-methoxy-2-methyl-4-[(2R)-oxiran-2-yl]but-1-enyl]-trimethylsilane is CO[C@@H](C[C@@H]1CO1)/C(C)=C/[Si](C)(C)C.
What is the InChIKey of [(E,3S)-3-methoxy-2-methyl-4-[(2R)-oxiran-2-yl]but-1-enyl]-trimethylsilane?
The InChIKey is VJTBWJHVIYXCBL-OJLMFNQTSA-N. The full InChI is InChI=1S/C11H22O2Si/c1-9(8-14(3,4)5)11(12-2)6-10-7-13-10/h8,10-11H,6-7H2,1-5H3/b9-8+/t10-,11+/m1/s1.
What are the key properties of [(E,3S)-3-methoxy-2-methyl-4-[(2R)-oxiran-2-yl]but-1-enyl]-trimethylsilane?
[(E,3S)-3-methoxy-2-methyl-4-[(2R)-oxiran-2-yl]but-1-enyl]-trimethylsilane has a molecular weight of 214.38 g/mol, XLogP of 2.61, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,3S)-3-methoxy-2-methyl-4-[(2R)-oxiran-2-yl]but-1-enyl]-trimethylsilane is sourced from PubChem (CID 10954921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).