C5H4F8 — CID 10954960
1,1,1,2,2,4,4,4-octafluoro-3-methylbutane (PubChem CID 10954960) has the molecular formula C5H4F8 and a molecular weight of 216.07 g/mol. Its IUPAC name is 1,1,1,2,2,4,4,4-octafluoro-3-methylbutane.
| Compound Name | 1,1,1,2,2,4,4,4-octafluoro-3-methylbutane |
|---|---|
| PubChem CID | 10954960 |
| Molecular Formula | C5H4F8 |
| Molecular Weight | 216.07 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 1,1,1,2,2,4,4,4-octafluoro-3-methylbutane |
| SMILES | CC(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H4F8/c1-2(4(8,9)10)3(6,7)5(11,12)13/h2H,1H3 |
| InChIKey | HPNFIKMZNRYMGS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.07 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|