C14H22O2 — CID 10955164
(1S,2S,3S,4S)-1-methoxy-2,3-dimethyl-3-prop-2-enylbicyclo[2.2.2]oct-5-en-2-ol (PubChem CID 10955164) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (1S,2S,3S,4S)-1-methoxy-2,3-dimethyl-3-prop-2-enylbicyclo[2.2.2]oct-5-en-2-ol.
| Compound Name | (1S,2S,3S,4S)-1-methoxy-2,3-dimethyl-3-prop-2-enylbicyclo[2.2.2]oct-5-en-2-ol |
|---|---|
| PubChem CID | 10955164 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (1S,2S,3S,4S)-1-methoxy-2,3-dimethyl-3-prop-2-enylbicyclo[2.2.2]oct-5-en-2-ol |
| SMILES | C=CC[C@@]1(C)[C@@H]2C=C[C@@](OC)(CC2)[C@@]1(C)O |
| InChI | InChI=1S/C14H22O2/c1-5-8-12(2)11-6-9-14(16-4,10-7-11)13(12,3)15/h5-6,9,11,15H,1,7-8,10H2,2-4H3/t11-,12+,13+,14-/m1/s1 |
| InChIKey | PDQYGALAOALDBD-ZOBORPQBSA-N |
| XLogP | 2.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|