C12H18O4 — CID 10955258
(2S,3aR,7aR)-3a-hydroxyspiro[5,6,7,7a-tetrahydro-4H-1-benzofuran-2,2'-oxane]-3-one (PubChem CID 10955258) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is (2S,3aR,7aR)-3a-hydroxyspiro[5,6,7,7a-tetrahydro-4H-1-benzofuran-2,2'-oxane]-3-one.
| Compound Name | (2S,3aR,7aR)-3a-hydroxyspiro[5,6,7,7a-tetrahydro-4H-1-benzofuran-2,2'-oxane]-3-one |
|---|---|
| PubChem CID | 10955258 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (2S,3aR,7aR)-3a-hydroxyspiro[5,6,7,7a-tetrahydro-4H-1-benzofuran-2,2'-oxane]-3-one |
| SMILES | O=C1[C@]2(CCCCO2)O[C@@H]2CCCC[C@]12O |
| InChI | InChI=1S/C12H18O4/c13-10-11(14)6-2-1-5-9(11)16-12(10)7-3-4-8-15-12/h9,14H,1-8H2/t9-,11-,12+/m1/s1 |
| InChIKey | AFXXWRGSBSAXAU-JLLWLGSASA-N |
| XLogP | 1.16 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |