About (4S)-2,6,6-trimethyl-4-trimethylsilyloxycyclohex-2-en-1-one
(4S)-2,6,6-trimethyl-4-trimethylsilyloxycyclohex-2-en-1-one (PubChem CID 10955282) has the molecular formula C12H22O2Si
and a molecular weight of 226.39 g/mol. Its IUPAC name is (4S)-2,6,6-trimethyl-4-trimethylsilyloxycyclohex-2-en-1-one.
Molecular Properties
| Compound Name | (4S)-2,6,6-trimethyl-4-trimethylsilyloxycyclohex-2-en-1-one |
| PubChem CID | 10955282 |
| Molecular Formula | C12H22O2Si |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | (4S)-2,6,6-trimethyl-4-trimethylsilyloxycyclohex-2-en-1-one |
| SMILES | CC1=C[C@@H](O[Si](C)(C)C)CC(C)(C)C1=O |
| InChI | InChI=1S/C12H22O2Si/c1-9-7-10(14-15(4,5)6)8-12(2,3)11(9)13/h7,10H,8H2,1-6H3/t10-/m1/s1 |
| InChIKey | UMNDVDSVXJZJDI-SNVBAGLBSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4S)-2,6,6-trimethyl-4-trimethylsilyloxycyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2,6,6-trimethyl-4-trimethylsilyloxycyclohex-2-en-1-one?
The IUPAC name of (4S)-2,6,6-trimethyl-4-trimethylsilyloxycyclohex-2-en-1-one (CID 10955282) is (4S)-2,6,6-trimethyl-4-trimethylsilyloxycyclohex-2-en-1-one.
What is the SMILES notation for (4S)-2,6,6-trimethyl-4-trimethylsilyloxycyclohex-2-en-1-one?
The canonical SMILES for (4S)-2,6,6-trimethyl-4-trimethylsilyloxycyclohex-2-en-1-one is CC1=C[C@@H](O[Si](C)(C)C)CC(C)(C)C1=O.
What is the InChIKey of (4S)-2,6,6-trimethyl-4-trimethylsilyloxycyclohex-2-en-1-one?
The InChIKey is UMNDVDSVXJZJDI-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H22O2Si/c1-9-7-10(14-15(4,5)6)8-12(2,3)11(9)13/h7,10H,8H2,1-6H3/t10-/m1/s1.
What are the key properties of (4S)-2,6,6-trimethyl-4-trimethylsilyloxycyclohex-2-en-1-one?
(4S)-2,6,6-trimethyl-4-trimethylsilyloxycyclohex-2-en-1-one has a molecular weight of 226.39 g/mol, XLogP of 3.15, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2,6,6-trimethyl-4-trimethylsilyloxycyclohex-2-en-1-one is sourced from PubChem (CID 10955282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).