C12H20O4 — CID 10955320
methyl 2-[(3aS,4R,6aR)-2-ethoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]acetate (PubChem CID 10955320) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is methyl 2-[(3aS,4R,6aR)-2-ethoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]acetate.
| Compound Name | methyl 2-[(3aS,4R,6aR)-2-ethoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]acetate |
|---|---|
| PubChem CID | 10955320 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | methyl 2-[(3aS,4R,6aR)-2-ethoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]acetate |
| SMILES | CCOC1C[C@H]2[C@@H](CC(=O)OC)CC[C@H]2O1 |
| InChI | InChI=1S/C12H20O4/c1-3-15-12-7-9-8(6-11(13)14-2)4-5-10(9)16-12/h8-10,12H,3-7H2,1-2H3/t8-,9+,10-,12?/m1/s1 |
| InChIKey | IBILOBUDCVECKC-SMRSKGNSSA-N |
| XLogP | 1.73 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |