About (5S)-5-[(1R,2R)-1-hydroxy-2-trimethylsilylbut-3-enyl]oxolan-2-one
(5S)-5-[(1R,2R)-1-hydroxy-2-trimethylsilylbut-3-enyl]oxolan-2-one (PubChem CID 10955333) has the molecular formula C11H20O3Si
and a molecular weight of 228.36 g/mol. Its IUPAC name is (5S)-5-[(1R,2R)-1-hydroxy-2-trimethylsilylbut-3-enyl]oxolan-2-one.
Molecular Properties
| Compound Name | (5S)-5-[(1R,2R)-1-hydroxy-2-trimethylsilylbut-3-enyl]oxolan-2-one |
| PubChem CID | 10955333 |
| Molecular Formula | C11H20O3Si |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (5S)-5-[(1R,2R)-1-hydroxy-2-trimethylsilylbut-3-enyl]oxolan-2-one |
| SMILES | C=C[C@H]([C@H](O)[C@@H]1CCC(=O)O1)[Si](C)(C)C |
| InChI | InChI=1S/C11H20O3Si/c1-5-9(15(2,3)4)11(13)8-6-7-10(12)14-8/h5,8-9,11,13H,1,6-7H2,2-4H3/t8-,9+,11+/m0/s1 |
| InChIKey | VYRLWCGTIDZUQE-IQJOONFLSA-N |
| XLogP | 1.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-[(1R,2R)-1-hydroxy-2-trimethylsilylbut-3-enyl]oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-[(1R,2R)-1-hydroxy-2-trimethylsilylbut-3-enyl]oxolan-2-one?
The IUPAC name of (5S)-5-[(1R,2R)-1-hydroxy-2-trimethylsilylbut-3-enyl]oxolan-2-one (CID 10955333) is (5S)-5-[(1R,2R)-1-hydroxy-2-trimethylsilylbut-3-enyl]oxolan-2-one.
What is the SMILES notation for (5S)-5-[(1R,2R)-1-hydroxy-2-trimethylsilylbut-3-enyl]oxolan-2-one?
The canonical SMILES for (5S)-5-[(1R,2R)-1-hydroxy-2-trimethylsilylbut-3-enyl]oxolan-2-one is C=C[C@H]([C@H](O)[C@@H]1CCC(=O)O1)[Si](C)(C)C.
What is the InChIKey of (5S)-5-[(1R,2R)-1-hydroxy-2-trimethylsilylbut-3-enyl]oxolan-2-one?
The InChIKey is VYRLWCGTIDZUQE-IQJOONFLSA-N. The full InChI is InChI=1S/C11H20O3Si/c1-5-9(15(2,3)4)11(13)8-6-7-10(12)14-8/h5,8-9,11,13H,1,6-7H2,2-4H3/t8-,9+,11+/m0/s1.
What are the key properties of (5S)-5-[(1R,2R)-1-hydroxy-2-trimethylsilylbut-3-enyl]oxolan-2-one?
(5S)-5-[(1R,2R)-1-hydroxy-2-trimethylsilylbut-3-enyl]oxolan-2-one has a molecular weight of 228.36 g/mol, XLogP of 1.95, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-[(1R,2R)-1-hydroxy-2-trimethylsilylbut-3-enyl]oxolan-2-one is sourced from PubChem (CID 10955333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).