C14H30O2 — CID 10955388
(4S,8S)-1,1-dimethoxy-4,8-dimethyldecane (PubChem CID 10955388) has the molecular formula C14H30O2 and a molecular weight of 230.39 g/mol. Its IUPAC name is (4S,8S)-1,1-dimethoxy-4,8-dimethyldecane.
| Compound Name | (4S,8S)-1,1-dimethoxy-4,8-dimethyldecane |
|---|---|
| PubChem CID | 10955388 |
| Molecular Formula | C14H30O2 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.22 |
| IUPAC Name | (4S,8S)-1,1-dimethoxy-4,8-dimethyldecane |
| SMILES | CC[C@H](C)CCC[C@H](C)CCC(OC)OC |
| InChI | InChI=1S/C14H30O2/c1-6-12(2)8-7-9-13(3)10-11-14(15-4)16-5/h12-14H,6-11H2,1-5H3/t12-,13-/m0/s1 |
| InChIKey | KMLXVJNZWSTLHY-STQMWFEESA-N |
| XLogP | 4.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|