C11H12O4S — CID 10955679
2,2-dimethyl-5-(thiophen-2-ylmethyl)-1,3-dioxane-4,6-dione (PubChem CID 10955679) has the molecular formula C11H12O4S and a molecular weight of 240.28 g/mol. Its IUPAC name is 2,2-dimethyl-5-(thiophen-2-ylmethyl)-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-(thiophen-2-ylmethyl)-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 10955679 |
| Molecular Formula | C11H12O4S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 2,2-dimethyl-5-(thiophen-2-ylmethyl)-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(Cc2cccs2)C(=O)O1 |
| InChI | InChI=1S/C11H12O4S/c1-11(2)14-9(12)8(10(13)15-11)6-7-4-3-5-16-7/h3-5,8H,6H2,1-2H3 |
| InChIKey | VRJKHRRJECUIOS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|