C18H28 — CID 10955809
(5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-1-yne (PubChem CID 10955809) has the molecular formula C18H28 and a molecular weight of 244.42 g/mol. Its IUPAC name is (5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-1-yne.
| Compound Name | (5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-1-yne |
|---|---|
| PubChem CID | 10955809 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | (5E,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-1-yne |
| SMILES | C#CCC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C18H28/c1-6-7-8-12-17(4)14-10-15-18(5)13-9-11-16(2)3/h1,11-12,15H,7-10,13-14H2,2-5H3/b17-12+,18-15+ |
| InChIKey | CHOZHHKCNAKMFO-NLKSIUOISA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|