C8H10ClF3O3 — CID 10955865
ethyl (E)-4-chloro-3-ethoxy-2,4,4-trifluorobut-2-enoate (PubChem CID 10955865) has the molecular formula C8H10ClF3O3 and a molecular weight of 246.61 g/mol. Its IUPAC name is ethyl (E)-4-chloro-3-ethoxy-2,4,4-trifluorobut-2-enoate.
| Compound Name | ethyl (E)-4-chloro-3-ethoxy-2,4,4-trifluorobut-2-enoate |
|---|---|
| PubChem CID | 10955865 |
| Molecular Formula | C8H10ClF3O3 |
| Molecular Weight | 246.61 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | ethyl (E)-4-chloro-3-ethoxy-2,4,4-trifluorobut-2-enoate |
| SMILES | CCOC(=O)/C(F)=C(\OCC)C(F)(F)Cl |
| InChI | InChI=1S/C8H10ClF3O3/c1-3-14-6(8(9,11)12)5(10)7(13)15-4-2/h3-4H2,1-2H3/b6-5+ |
| InChIKey | XGTDBBREKUGWQZ-AATRIKPKSA-N |
| XLogP | 2.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.61 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|