About ethyl (E)-4-chloro-3-ethoxy-2,4,4-trifluorobut-2-enoate
ethyl (E)-4-chloro-3-ethoxy-2,4,4-trifluorobut-2-enoate (PubChem CID 10955865) has the molecular formula C8H10ClF3O3
and a molecular weight of 246.61 g/mol. Its IUPAC name is ethyl (E)-4-chloro-3-ethoxy-2,4,4-trifluorobut-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-4-chloro-3-ethoxy-2,4,4-trifluorobut-2-enoate |
| PubChem CID | 10955865 |
| Molecular Formula | C8H10ClF3O3 |
| Molecular Weight | 246.61 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | ethyl (E)-4-chloro-3-ethoxy-2,4,4-trifluorobut-2-enoate |
| SMILES | CCOC(=O)/C(F)=C(\OCC)C(F)(F)Cl |
| InChI | InChI=1S/C8H10ClF3O3/c1-3-14-6(8(9,11)12)5(10)7(13)15-4-2/h3-4H2,1-2H3/b6-5+ |
| InChIKey | XGTDBBREKUGWQZ-AATRIKPKSA-N |
| XLogP | 2.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.61 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-4-chloro-3-ethoxy-2,4,4-trifluorobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-4-chloro-3-ethoxy-2,4,4-trifluorobut-2-enoate?
The IUPAC name of ethyl (E)-4-chloro-3-ethoxy-2,4,4-trifluorobut-2-enoate (CID 10955865) is ethyl (E)-4-chloro-3-ethoxy-2,4,4-trifluorobut-2-enoate.
What is the SMILES notation for ethyl (E)-4-chloro-3-ethoxy-2,4,4-trifluorobut-2-enoate?
The canonical SMILES for ethyl (E)-4-chloro-3-ethoxy-2,4,4-trifluorobut-2-enoate is CCOC(=O)/C(F)=C(\OCC)C(F)(F)Cl.
What is the InChIKey of ethyl (E)-4-chloro-3-ethoxy-2,4,4-trifluorobut-2-enoate?
The InChIKey is XGTDBBREKUGWQZ-AATRIKPKSA-N. The full InChI is InChI=1S/C8H10ClF3O3/c1-3-14-6(8(9,11)12)5(10)7(13)15-4-2/h3-4H2,1-2H3/b6-5+.
What are the key properties of ethyl (E)-4-chloro-3-ethoxy-2,4,4-trifluorobut-2-enoate?
ethyl (E)-4-chloro-3-ethoxy-2,4,4-trifluorobut-2-enoate has a molecular weight of 246.61 g/mol, XLogP of 2.60, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-4-chloro-3-ethoxy-2,4,4-trifluorobut-2-enoate is sourced from PubChem (CID 10955865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).