C14H15N5 — CID 10956074
N-methyl-2-(2-phenylethyl)-7H-purin-6-amine (PubChem CID 10956074) has the molecular formula C14H15N5 and a molecular weight of 253.31 g/mol. Its IUPAC name is N-methyl-2-(2-phenylethyl)-7H-purin-6-amine.
| Compound Name | N-methyl-2-(2-phenylethyl)-7H-purin-6-amine |
|---|---|
| PubChem CID | 10956074 |
| Molecular Formula | C14H15N5 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N-methyl-2-(2-phenylethyl)-7H-purin-6-amine |
| SMILES | CNc1nc(CCc2ccccc2)nc2nc[nH]c12 |
| InChI | InChI=1S/C14H15N5/c1-15-13-12-14(17-9-16-12)19-11(18-13)8-7-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H2,15,16,17,18,19) |
| InChIKey | LJQALFKNXWAZQS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |