C14H16F2S — CID 10956116
(1-cyclohexyl-2,2-difluoroethenyl)sulfanylbenzene (PubChem CID 10956116) has the molecular formula C14H16F2S and a molecular weight of 254.34 g/mol. Its IUPAC name is (1-cyclohexyl-2,2-difluoroethenyl)sulfanylbenzene.
| Compound Name | (1-cyclohexyl-2,2-difluoroethenyl)sulfanylbenzene |
|---|---|
| PubChem CID | 10956116 |
| Molecular Formula | C14H16F2S |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (1-cyclohexyl-2,2-difluoroethenyl)sulfanylbenzene |
| SMILES | FC(F)=C(Sc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C14H16F2S/c15-14(16)13(11-7-3-1-4-8-11)17-12-9-5-2-6-10-12/h2,5-6,9-11H,1,3-4,7-8H2 |
| InChIKey | SHDKGNHIHYKUOV-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |