C13H11NO5 — CID 10956319
benzyl (2S,5R)-3,7-dioxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 10956319) has the molecular formula C13H11NO5 and a molecular weight of 261.23 g/mol. Its IUPAC name is benzyl (2S,5R)-3,7-dioxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzyl (2S,5R)-3,7-dioxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 10956319 |
| Molecular Formula | C13H11NO5 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | benzyl (2S,5R)-3,7-dioxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)[C@H]1C(=O)O[C@@H]2CC(=O)N12 |
| InChI | InChI=1S/C13H11NO5/c15-9-6-10-14(9)11(13(17)19-10)12(16)18-7-8-4-2-1-3-5-8/h1-5,10-11H,6-7H2/t10-,11+/m1/s1 |
| InChIKey | RXEMGNHTSOXNFP-MNOVXSKESA-N |
| XLogP | 0.21 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|