C19H19N — CID 10956340
(1R,9R,11S)-9-methyl-2-azapentacyclo[9.8.0.01,9.03,8.014,19]nonadeca-3,5,7,14,16,18-hexaene (PubChem CID 10956340) has the molecular formula C19H19N and a molecular weight of 261.37 g/mol. Its IUPAC name is (1R,9R,11S)-9-methyl-2-azapentacyclo[9.8.0.01,9.03,8.014,19]nonadeca-3,5,7,14,16,18-hexaene.
| Compound Name | (1R,9R,11S)-9-methyl-2-azapentacyclo[9.8.0.01,9.03,8.014,19]nonadeca-3,5,7,14,16,18-hexaene |
|---|---|
| PubChem CID | 10956340 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | (1R,9R,11S)-9-methyl-2-azapentacyclo[9.8.0.01,9.03,8.014,19]nonadeca-3,5,7,14,16,18-hexaene |
| SMILES | C[C@]12C[C@@H]3CCc4ccccc4[C@@]31Nc1ccccc12 |
| InChI | InChI=1S/C19H19N/c1-18-12-14-11-10-13-6-2-3-7-15(13)19(14,18)20-17-9-5-4-8-16(17)18/h2-9,14,20H,10-12H2,1H3/t14-,18+,19-/m0/s1 |
| InChIKey | HXJRCXHVTKJHGA-KYNGSXCRSA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |