About Benzyl Alpha-D-Mannopyranoside
Benzyl Alpha-D-Mannopyranoside (PubChem CID 10956572) has the molecular formula C13H18O6
and a molecular weight of 270.28 g/mol. Its IUPAC name is (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-phenylmethoxyoxane-3,4,5-triol.
Molecular Properties
| Compound Name | Benzyl Alpha-D-Mannopyranoside |
| PubChem CID | 10956572 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-phenylmethoxyoxane-3,4,5-triol |
| SMILES | C1=CC=C(C=C1)CO[C@@H]2[C@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
| InChI | InChI=1S/C13H18O6/c14-6-9-10(15)11(16)12(17)13(19-9)18-7-8-4-2-1-3-5-8/h1-5,9-17H,6-7H2/t9-,10-,11+,12+,13+/m1/s1 |
| InChIKey | GKHCBYYBLTXYEV-BNDIWNMDSA-N |
| XLogP | -0.70 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | 268 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze Benzyl Alpha-D-Mannopyranoside with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Benzyl Alpha-D-Mannopyranoside?
The IUPAC name of Benzyl Alpha-D-Mannopyranoside (CID 10956572) is (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-phenylmethoxyoxane-3,4,5-triol.
What is the SMILES notation for Benzyl Alpha-D-Mannopyranoside?
The canonical SMILES for Benzyl Alpha-D-Mannopyranoside is C1=CC=C(C=C1)CO[C@@H]2[C@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O.
What is the InChIKey of Benzyl Alpha-D-Mannopyranoside?
The InChIKey is GKHCBYYBLTXYEV-BNDIWNMDSA-N. The full InChI is InChI=1S/C13H18O6/c14-6-9-10(15)11(16)12(17)13(19-9)18-7-8-4-2-1-3-5-8/h1-5,9-17H,6-7H2/t9-,10-,11+,12+,13+/m1/s1.
What are the key properties of Benzyl Alpha-D-Mannopyranoside?
Benzyl Alpha-D-Mannopyranoside has a molecular weight of 270.28 g/mol, XLogP of -0.70, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Benzyl Alpha-D-Mannopyranoside is sourced from PubChem (CID 10956572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).