C19H28O — CID 10956665
(1S,2R,4R)-1-methyl-2-(2-phenylpropan-2-yl)-4-prop-1-en-2-ylcyclohexan-1-ol (PubChem CID 10956665) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is (1S,2R,4R)-1-methyl-2-(2-phenylpropan-2-yl)-4-prop-1-en-2-ylcyclohexan-1-ol.
| Compound Name | (1S,2R,4R)-1-methyl-2-(2-phenylpropan-2-yl)-4-prop-1-en-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 10956665 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | (1S,2R,4R)-1-methyl-2-(2-phenylpropan-2-yl)-4-prop-1-en-2-ylcyclohexan-1-ol |
| SMILES | C=C(C)[C@@H]1CC[C@](C)(O)[C@@H](C(C)(C)c2ccccc2)C1 |
| InChI | InChI=1S/C19H28O/c1-14(2)15-11-12-19(5,20)17(13-15)18(3,4)16-9-7-6-8-10-16/h6-10,15,17,20H,1,11-13H2,2-5H3/t15-,17-,19+/m1/s1 |
| InChIKey | IXAKDJOCPSVYMR-SUMDDJOVSA-N |
| XLogP | 4.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|