C13H13NO4S — CID 10956852
(3aS,6aR)-3-(4-methylphenyl)sulfonyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]oxazol-2-one (PubChem CID 10956852) has the molecular formula C13H13NO4S and a molecular weight of 279.32 g/mol. Its IUPAC name is (3aS,6aR)-3-(4-methylphenyl)sulfonyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]oxazol-2-one.
| Compound Name | (3aS,6aR)-3-(4-methylphenyl)sulfonyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 10956852 |
| Molecular Formula | C13H13NO4S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | (3aS,6aR)-3-(4-methylphenyl)sulfonyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]oxazol-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)O[C@@H]3CC=C[C@@H]32)cc1 |
| InChI | InChI=1S/C13H13NO4S/c1-9-5-7-10(8-6-9)19(16,17)14-11-3-2-4-12(11)18-13(14)15/h2-3,5-8,11-12H,4H2,1H3/t11-,12+/m0/s1 |
| InChIKey | NMCPSHAFGWDFHZ-NWDGAFQWSA-N |
| XLogP | 1.83 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|