About [4-(4-fluorophenyl)-2,5-di(propan-2-yl)thiophen-3-yl]methanol
[4-(4-fluorophenyl)-2,5-di(propan-2-yl)thiophen-3-yl]methanol (PubChem CID 10957303) has the molecular formula C17H21FOS
and a molecular weight of 292.42 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-2,5-di(propan-2-yl)thiophen-3-yl]methanol.
Molecular Properties
| Compound Name | [4-(4-fluorophenyl)-2,5-di(propan-2-yl)thiophen-3-yl]methanol |
| PubChem CID | 10957303 |
| Molecular Formula | C17H21FOS |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | [4-(4-fluorophenyl)-2,5-di(propan-2-yl)thiophen-3-yl]methanol |
| SMILES | CC(C)c1sc(C(C)C)c(-c2ccc(F)cc2)c1CO |
| InChI | InChI=1S/C17H21FOS/c1-10(2)16-14(9-19)15(17(20-16)11(3)4)12-5-7-13(18)8-6-12/h5-8,10-11,19H,9H2,1-4H3 |
| InChIKey | UVGHDSGGRVSVLP-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-(4-fluorophenyl)-2,5-di(propan-2-yl)thiophen-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-fluorophenyl)-2,5-di(propan-2-yl)thiophen-3-yl]methanol?
The IUPAC name of [4-(4-fluorophenyl)-2,5-di(propan-2-yl)thiophen-3-yl]methanol (CID 10957303) is [4-(4-fluorophenyl)-2,5-di(propan-2-yl)thiophen-3-yl]methanol.
What is the SMILES notation for [4-(4-fluorophenyl)-2,5-di(propan-2-yl)thiophen-3-yl]methanol?
The canonical SMILES for [4-(4-fluorophenyl)-2,5-di(propan-2-yl)thiophen-3-yl]methanol is CC(C)c1sc(C(C)C)c(-c2ccc(F)cc2)c1CO.
What is the InChIKey of [4-(4-fluorophenyl)-2,5-di(propan-2-yl)thiophen-3-yl]methanol?
The InChIKey is UVGHDSGGRVSVLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21FOS/c1-10(2)16-14(9-19)15(17(20-16)11(3)4)12-5-7-13(18)8-6-12/h5-8,10-11,19H,9H2,1-4H3.
What are the key properties of [4-(4-fluorophenyl)-2,5-di(propan-2-yl)thiophen-3-yl]methanol?
[4-(4-fluorophenyl)-2,5-di(propan-2-yl)thiophen-3-yl]methanol has a molecular weight of 292.42 g/mol, XLogP of 5.29, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-fluorophenyl)-2,5-di(propan-2-yl)thiophen-3-yl]methanol is sourced from PubChem (CID 10957303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).